C13H17BrN2O3S — CID 63607782
4-(4-bromo-3-methylphenyl)sulfonyl-3,3-dimethylpiperazin-2-one (PubChem CID 63607782) has the molecular formula C13H17BrN2O3S and a molecular weight of 361.26 g/mol. Its IUPAC name is 4-(4-bromo-3-methylphenyl)sulfonyl-3,3-dimethylpiperazin-2-one.
| Compound Name | 4-(4-bromo-3-methylphenyl)sulfonyl-3,3-dimethylpiperazin-2-one |
|---|---|
| PubChem CID | 63607782 |
| Molecular Formula | C13H17BrN2O3S |
| Molecular Weight | 361.26 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | 4-(4-bromo-3-methylphenyl)sulfonyl-3,3-dimethylpiperazin-2-one |
| SMILES | Cc1cc(S(=O)(=O)N2CCNC(=O)C2(C)C)ccc1Br |
| InChI | InChI=1S/C13H17BrN2O3S/c1-9-8-10(4-5-11(9)14)20(18,19)16-7-6-15-12(17)13(16,2)3/h4-5,8H,6-7H2,1-3H3,(H,15,17) |
| InChIKey | KTRMQERPGVRTCA-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.26 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |