C11H13N3O3S — CID 62918180
5-amino-2-(3-hydroxypyrrolidin-1-yl)sulfonylbenzonitrile (PubChem CID 62918180) has the molecular formula C11H13N3O3S and a molecular weight of 267.31 g/mol. Its IUPAC name is 5-amino-2-(3-hydroxypyrrolidin-1-yl)sulfonylbenzonitrile.
| Compound Name | 5-amino-2-(3-hydroxypyrrolidin-1-yl)sulfonylbenzonitrile |
|---|---|
| PubChem CID | 62918180 |
| Molecular Formula | C11H13N3O3S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 5-amino-2-(3-hydroxypyrrolidin-1-yl)sulfonylbenzonitrile |
| SMILES | N#Cc1cc(N)ccc1S(=O)(=O)N1CCC(O)C1 |
| InChI | InChI=1S/C11H13N3O3S/c12-6-8-5-9(13)1-2-11(8)18(16,17)14-4-3-10(15)7-14/h1-2,5,10,15H,3-4,7,13H2 |
| InChIKey | BQPZNBWLDSXHDO-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 107.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|