C12H14FNO4S2 — CID 61073207
2-fluoro-5-(1,4-thiazepan-4-ylsulfonyl)benzoic acid (PubChem CID 61073207) has the molecular formula C12H14FNO4S2 and a molecular weight of 319.38 g/mol. Its IUPAC name is 2-fluoro-5-(1,4-thiazepan-4-ylsulfonyl)benzoic acid.
| Compound Name | 2-fluoro-5-(1,4-thiazepan-4-ylsulfonyl)benzoic acid |
|---|---|
| PubChem CID | 61073207 |
| Molecular Formula | C12H14FNO4S2 |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | 2-fluoro-5-(1,4-thiazepan-4-ylsulfonyl)benzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)N2CCCSCC2)ccc1F |
| InChI | InChI=1S/C12H14FNO4S2/c13-11-3-2-9(8-10(11)12(15)16)20(17,18)14-4-1-6-19-7-5-14/h2-3,8H,1,4-7H2,(H,15,16) |
| InChIKey | ICBIAQFIRHDUPA-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |