C12H15Cl2NO2S2 — CID 107091043
4-[3-chloro-4-(chloromethyl)phenyl]sulfonyl-1,4-thiazepane (PubChem CID 107091043) has the molecular formula C12H15Cl2NO2S2 and a molecular weight of 340.30 g/mol. Its IUPAC name is 4-[3-chloro-4-(chloromethyl)phenyl]sulfonyl-1,4-thiazepane.
| Compound Name | 4-[3-chloro-4-(chloromethyl)phenyl]sulfonyl-1,4-thiazepane |
|---|---|
| PubChem CID | 107091043 |
| Molecular Formula | C12H15Cl2NO2S2 |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 338.99 |
| IUPAC Name | 4-[3-chloro-4-(chloromethyl)phenyl]sulfonyl-1,4-thiazepane |
| SMILES | O=S(=O)(c1ccc(CCl)c(Cl)c1)N1CCCSCC1 |
| InChI | InChI=1S/C12H15Cl2NO2S2/c13-9-10-2-3-11(8-12(10)14)19(16,17)15-4-1-6-18-7-5-15/h2-3,8H,1,4-7,9H2 |
| InChIKey | LNJVBXOCDKHAHK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|