C14H21NO2S2 — CID 86992430
4-(4-propan-2-ylphenyl)sulfonyl-1,4-thiazepane (PubChem CID 86992430) has the molecular formula C14H21NO2S2 and a molecular weight of 299.46 g/mol. Its IUPAC name is 4-(4-propan-2-ylphenyl)sulfonyl-1,4-thiazepane.
| Compound Name | 4-(4-propan-2-ylphenyl)sulfonyl-1,4-thiazepane |
|---|---|
| PubChem CID | 86992430 |
| Molecular Formula | C14H21NO2S2 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 4-(4-propan-2-ylphenyl)sulfonyl-1,4-thiazepane |
| SMILES | CC(C)c1ccc(S(=O)(=O)N2CCCSCC2)cc1 |
| InChI | InChI=1S/C14H21NO2S2/c1-12(2)13-4-6-14(7-5-13)19(16,17)15-8-3-10-18-11-9-15/h4-7,12H,3,8-11H2,1-2H3 |
| InChIKey | CVSZJCZRMIIBMB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |