C15H24N2O2S2 — CID 43506982
N-[1-(4-thiomorpholin-4-ylsulfonylphenyl)ethyl]propan-1-amine (PubChem CID 43506982) has the molecular formula C15H24N2O2S2 and a molecular weight of 328.50 g/mol. Its IUPAC name is N-[1-(4-thiomorpholin-4-ylsulfonylphenyl)ethyl]propan-1-amine.
| Compound Name | N-[1-(4-thiomorpholin-4-ylsulfonylphenyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 43506982 |
| Molecular Formula | C15H24N2O2S2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | N-[1-(4-thiomorpholin-4-ylsulfonylphenyl)ethyl]propan-1-amine |
| SMILES | CCCNC(C)c1ccc(S(=O)(=O)N2CCSCC2)cc1 |
| InChI | InChI=1S/C15H24N2O2S2/c1-3-8-16-13(2)14-4-6-15(7-5-14)21(18,19)17-9-11-20-12-10-17/h4-7,13,16H,3,8-12H2,1-2H3 |
| InChIKey | PSGGQLFSRKSBQT-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |