C12H16N2O2S3 — CID 61419371
4-(1,4-thiazepan-4-ylsulfonyl)benzenecarbothioamide (PubChem CID 61419371) has the molecular formula C12H16N2O2S3 and a molecular weight of 316.47 g/mol. Its IUPAC name is 4-(1,4-thiazepan-4-ylsulfonyl)benzenecarbothioamide.
| Compound Name | 4-(1,4-thiazepan-4-ylsulfonyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 61419371 |
| Molecular Formula | C12H16N2O2S3 |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 4-(1,4-thiazepan-4-ylsulfonyl)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(S(=O)(=O)N2CCCSCC2)cc1 |
| InChI | InChI=1S/C12H16N2O2S3/c13-12(17)10-2-4-11(5-3-10)19(15,16)14-6-1-8-18-9-7-14/h2-5H,1,6-9H2,(H2,13,17) |
| InChIKey | MALBYOUOLMUXQQ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|