C11H17N3O3S2 — CID 86992432
1-methyl-4-(1,4-thiazepan-4-ylsulfonyl)pyrrole-2-carboxamide (PubChem CID 86992432) has the molecular formula C11H17N3O3S2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 1-methyl-4-(1,4-thiazepan-4-ylsulfonyl)pyrrole-2-carboxamide.
| Compound Name | 1-methyl-4-(1,4-thiazepan-4-ylsulfonyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 86992432 |
| Molecular Formula | C11H17N3O3S2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 1-methyl-4-(1,4-thiazepan-4-ylsulfonyl)pyrrole-2-carboxamide |
| SMILES | Cn1cc(S(=O)(=O)N2CCCSCC2)cc1C(N)=O |
| InChI | InChI=1S/C11H17N3O3S2/c1-13-8-9(7-10(13)11(12)15)19(16,17)14-3-2-5-18-6-4-14/h7-8H,2-6H2,1H3,(H2,12,15) |
| InChIKey | GYOKKKKVGIVFPS-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 85.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |