C11H18N4O3S — CID 104976475
1-methyl-4-[(3S)-3-methylpiperazin-1-yl]sulfonylpyrrole-2-carboxamide (PubChem CID 104976475) has the molecular formula C11H18N4O3S and a molecular weight of 286.36 g/mol. Its IUPAC name is 1-methyl-4-[(3S)-3-methylpiperazin-1-yl]sulfonylpyrrole-2-carboxamide.
| Compound Name | 1-methyl-4-[(3S)-3-methylpiperazin-1-yl]sulfonylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 104976475 |
| Molecular Formula | C11H18N4O3S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 1-methyl-4-[(3S)-3-methylpiperazin-1-yl]sulfonylpyrrole-2-carboxamide |
| SMILES | C[C@H]1CN(S(=O)(=O)c2cc(C(N)=O)n(C)c2)CCN1 |
| InChI | InChI=1S/C11H18N4O3S/c1-8-6-15(4-3-13-8)19(17,18)9-5-10(11(12)16)14(2)7-9/h5,7-8,13H,3-4,6H2,1-2H3,(H2,12,16)/t8-/m0/s1 |
| InChIKey | OJIHNYZMGXYWIF-QMMMGPOBSA-N |
| XLogP | -0.89 |
| TPSA | 97.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |