C13H22N4O3S — CID 114960857
4-[3-(aminomethyl)-4-methylpiperidin-1-yl]sulfonyl-1-methylpyrrole-2-carboxamide (PubChem CID 114960857) has the molecular formula C13H22N4O3S and a molecular weight of 314.41 g/mol. Its IUPAC name is 4-[3-(aminomethyl)-4-methylpiperidin-1-yl]sulfonyl-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-[3-(aminomethyl)-4-methylpiperidin-1-yl]sulfonyl-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 114960857 |
| Molecular Formula | C13H22N4O3S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 4-[3-(aminomethyl)-4-methylpiperidin-1-yl]sulfonyl-1-methylpyrrole-2-carboxamide |
| SMILES | CC1CCN(S(=O)(=O)c2cc(C(N)=O)n(C)c2)CC1CN |
| InChI | InChI=1S/C13H22N4O3S/c1-9-3-4-17(7-10(9)6-14)21(19,20)11-5-12(13(15)18)16(2)8-11/h5,8-10H,3-4,6-7,14H2,1-2H3,(H2,15,18) |
| InChIKey | IGJMUMKPFXCFRB-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 111.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |