C15H24N4O4S — CID 30291355
1-methyl-4-[4-[(2S)-2-methylbutanoyl]piperazin-1-yl]sulfonylpyrrole-2-carboxamide (PubChem CID 30291355) has the molecular formula C15H24N4O4S and a molecular weight of 356.45 g/mol. Its IUPAC name is 1-methyl-4-[4-[(2S)-2-methylbutanoyl]piperazin-1-yl]sulfonylpyrrole-2-carboxamide.
| Compound Name | 1-methyl-4-[4-[(2S)-2-methylbutanoyl]piperazin-1-yl]sulfonylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 30291355 |
| Molecular Formula | C15H24N4O4S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 1-methyl-4-[4-[(2S)-2-methylbutanoyl]piperazin-1-yl]sulfonylpyrrole-2-carboxamide |
| SMILES | CC[C@H](C)C(=O)N1CCN(S(=O)(=O)c2cc(C(N)=O)n(C)c2)CC1 |
| InChI | InChI=1S/C15H24N4O4S/c1-4-11(2)15(21)18-5-7-19(8-6-18)24(22,23)12-9-13(14(16)20)17(3)10-12/h9-11H,4-8H2,1-3H3,(H2,16,20)/t11-/m0/s1 |
| InChIKey | ISNBFUKVFGIAGG-NSHDSACASA-N |
| XLogP | 0.00 |
| TPSA | 105.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |