C17H17Cl2FN4O4S — CID 24563506
4-[4-(2,4-dichloro-5-fluorobenzoyl)piperazin-1-yl]sulfonyl-1-methylpyrrole-2-carboxamide (PubChem CID 24563506) has the molecular formula C17H17Cl2FN4O4S and a molecular weight of 463.32 g/mol. Its IUPAC name is 4-[4-(2,4-dichloro-5-fluorobenzoyl)piperazin-1-yl]sulfonyl-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-[4-(2,4-dichloro-5-fluorobenzoyl)piperazin-1-yl]sulfonyl-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 24563506 |
| Molecular Formula | C17H17Cl2FN4O4S |
| Molecular Weight | 463.32 g/mol |
| Exact Mass | 462.03 |
| IUPAC Name | 4-[4-(2,4-dichloro-5-fluorobenzoyl)piperazin-1-yl]sulfonyl-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cc(S(=O)(=O)N2CCN(C(=O)c3cc(F)c(Cl)cc3Cl)CC2)cc1C(N)=O |
| InChI | InChI=1S/C17H17Cl2FN4O4S/c1-22-9-10(6-15(22)16(21)25)29(27,28)24-4-2-23(3-5-24)17(26)11-7-14(20)13(19)8-12(11)18/h6-9H,2-5H2,1H3,(H2,21,25) |
| InChIKey | VHISNKURVRBCEY-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 105.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.32 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|