C17H21N5O4S2 — CID 43036217
1-methyl-4-[4-(2-pyridin-4-ylsulfanylacetyl)piperazin-1-yl]sulfonylpyrrole-2-carboxamide (PubChem CID 43036217) has the molecular formula C17H21N5O4S2 and a molecular weight of 423.52 g/mol. Its IUPAC name is 1-methyl-4-[4-(2-pyridin-4-ylsulfanylacetyl)piperazin-1-yl]sulfonylpyrrole-2-carboxamide.
| Compound Name | 1-methyl-4-[4-(2-pyridin-4-ylsulfanylacetyl)piperazin-1-yl]sulfonylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 43036217 |
| Molecular Formula | C17H21N5O4S2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | 1-methyl-4-[4-(2-pyridin-4-ylsulfanylacetyl)piperazin-1-yl]sulfonylpyrrole-2-carboxamide |
| SMILES | Cn1cc(S(=O)(=O)N2CCN(C(=O)CSc3ccncc3)CC2)cc1C(N)=O |
| InChI | InChI=1S/C17H21N5O4S2/c1-20-11-14(10-15(20)17(18)24)28(25,26)22-8-6-21(7-9-22)16(23)12-27-13-2-4-19-5-3-13/h2-5,10-11H,6-9,12H2,1H3,(H2,18,24) |
| InChIKey | PSRTULJBMGMSKX-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 118.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |