C18H20N6O3S2 — CID 42965374
2-(1-methyltetrazol-5-yl)sulfanyl-1-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)ethanone (PubChem CID 42965374) has the molecular formula C18H20N6O3S2 and a molecular weight of 432.53 g/mol. Its IUPAC name is 2-(1-methyltetrazol-5-yl)sulfanyl-1-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)ethanone.
| Compound Name | 2-(1-methyltetrazol-5-yl)sulfanyl-1-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 42965374 |
| Molecular Formula | C18H20N6O3S2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 2-(1-methyltetrazol-5-yl)sulfanyl-1-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)ethanone |
| SMILES | Cn1nnnc1SCC(=O)N1CCN(S(=O)(=O)c2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C18H20N6O3S2/c1-22-18(19-20-21-22)28-13-17(25)23-8-10-24(11-9-23)29(26,27)16-7-6-14-4-2-3-5-15(14)12-16/h2-7,12H,8-11,13H2,1H3 |
| InChIKey | QHRALPQKICMEQH-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 101.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |