C20H22N6O3S2 — CID 2503306
1-[4-(benzenesulfonyl)piperazin-1-yl]-2-[1-(3-methylphenyl)tetrazol-5-yl]sulfanylethanone (PubChem CID 2503306) has the molecular formula C20H22N6O3S2 and a molecular weight of 458.57 g/mol. Its IUPAC name is 1-[4-(benzenesulfonyl)piperazin-1-yl]-2-[1-(3-methylphenyl)tetrazol-5-yl]sulfanylethanone.
| Compound Name | 1-[4-(benzenesulfonyl)piperazin-1-yl]-2-[1-(3-methylphenyl)tetrazol-5-yl]sulfanylethanone |
|---|---|
| PubChem CID | 2503306 |
| Molecular Formula | C20H22N6O3S2 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 1-[4-(benzenesulfonyl)piperazin-1-yl]-2-[1-(3-methylphenyl)tetrazol-5-yl]sulfanylethanone |
| SMILES | Cc1cccc(-n2nnnc2SCC(=O)N2CCN(S(=O)(=O)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C20H22N6O3S2/c1-16-6-5-7-17(14-16)26-20(21-22-23-26)30-15-19(27)24-10-12-25(13-11-24)31(28,29)18-8-3-2-4-9-18/h2-9,14H,10-13,15H2,1H3 |
| InChIKey | SPWWRJYHUQUQNG-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 101.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |