C20H21ClN6OS — CID 60608065
1-[4-(3-chlorophenyl)piperazin-1-yl]-2-[1-(3-methylphenyl)tetrazol-5-yl]sulfanylethanone (PubChem CID 60608065) has the molecular formula C20H21ClN6OS and a molecular weight of 428.95 g/mol. Its IUPAC name is 1-[4-(3-chlorophenyl)piperazin-1-yl]-2-[1-(3-methylphenyl)tetrazol-5-yl]sulfanylethanone.
| Compound Name | 1-[4-(3-chlorophenyl)piperazin-1-yl]-2-[1-(3-methylphenyl)tetrazol-5-yl]sulfanylethanone |
|---|---|
| PubChem CID | 60608065 |
| Molecular Formula | C20H21ClN6OS |
| Molecular Weight | 428.95 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 1-[4-(3-chlorophenyl)piperazin-1-yl]-2-[1-(3-methylphenyl)tetrazol-5-yl]sulfanylethanone |
| SMILES | Cc1cccc(-n2nnnc2SCC(=O)N2CCN(c3cccc(Cl)c3)CC2)c1 |
| InChI | InChI=1S/C20H21ClN6OS/c1-15-4-2-7-18(12-15)27-20(22-23-24-27)29-14-19(28)26-10-8-25(9-11-26)17-6-3-5-16(21)13-17/h2-7,12-13H,8-11,14H2,1H3 |
| InChIKey | XQDNLZHCOKPDQO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.95 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |