C19H18ClN7O3S — CID 1305905
1-[4-(3-chlorophenyl)piperazin-1-yl]-2-[1-(4-nitrophenyl)tetrazol-5-yl]sulfanylethanone (PubChem CID 1305905) has the molecular formula C19H18ClN7O3S and a molecular weight of 459.92 g/mol. Its IUPAC name is 1-[4-(3-chlorophenyl)piperazin-1-yl]-2-[1-(4-nitrophenyl)tetrazol-5-yl]sulfanylethanone.
| Compound Name | 1-[4-(3-chlorophenyl)piperazin-1-yl]-2-[1-(4-nitrophenyl)tetrazol-5-yl]sulfanylethanone |
|---|---|
| PubChem CID | 1305905 |
| Molecular Formula | C19H18ClN7O3S |
| Molecular Weight | 459.92 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | 1-[4-(3-chlorophenyl)piperazin-1-yl]-2-[1-(4-nitrophenyl)tetrazol-5-yl]sulfanylethanone |
| SMILES | O=C(CSc1nnnn1-c1ccc([N+](=O)[O-])cc1)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C19H18ClN7O3S/c20-14-2-1-3-17(12-14)24-8-10-25(11-9-24)18(28)13-31-19-21-22-23-26(19)15-4-6-16(7-5-15)27(29)30/h1-7,12H,8-11,13H2 |
| InChIKey | RBWABQATPJTHDY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.92 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|