C20H21ClN4O4 — CID 3499855
4-[4-(3-chlorophenyl)piperazin-1-yl]-N-(4-nitrophenyl)-4-oxobutanamide (PubChem CID 3499855) has the molecular formula C20H21ClN4O4 and a molecular weight of 416.87 g/mol. Its IUPAC name is 4-[4-(3-chlorophenyl)piperazin-1-yl]-N-(4-nitrophenyl)-4-oxobutanamide.
| Compound Name | 4-[4-(3-chlorophenyl)piperazin-1-yl]-N-(4-nitrophenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 3499855 |
| Molecular Formula | C20H21ClN4O4 |
| Molecular Weight | 416.87 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 4-[4-(3-chlorophenyl)piperazin-1-yl]-N-(4-nitrophenyl)-4-oxobutanamide |
| SMILES | O=C(CCC(=O)N1CCN(c2cccc(Cl)c2)CC1)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H21ClN4O4/c21-15-2-1-3-18(14-15)23-10-12-24(13-11-23)20(27)9-8-19(26)22-16-4-6-17(7-5-16)25(28)29/h1-7,14H,8-13H2,(H,22,26) |
| InChIKey | FFTSQMDXNGGWIE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.87 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|