C16H15N5OS — CID 853335
2-[1-(3-methylphenyl)tetrazol-5-yl]sulfanyl-N-phenylacetamide (PubChem CID 853335) has the molecular formula C16H15N5OS and a molecular weight of 325.40 g/mol. Its IUPAC name is 2-[1-(3-methylphenyl)tetrazol-5-yl]sulfanyl-N-phenylacetamide.
| Compound Name | 2-[1-(3-methylphenyl)tetrazol-5-yl]sulfanyl-N-phenylacetamide |
|---|---|
| PubChem CID | 853335 |
| Molecular Formula | C16H15N5OS |
| Molecular Weight | 325.40 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 2-[1-(3-methylphenyl)tetrazol-5-yl]sulfanyl-N-phenylacetamide |
| SMILES | Cc1cccc(-n2nnnc2SCC(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C16H15N5OS/c1-12-6-5-9-14(10-12)21-16(18-19-20-21)23-11-15(22)17-13-7-3-2-4-8-13/h2-10H,11H2,1H3,(H,17,22) |
| InChIKey | YGWDYBHTEMNEJH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |