C18H19N5OS — CID 42067738
2-[1-(3-methylphenyl)tetrazol-5-yl]sulfanyl-N-(2-phenylethyl)acetamide (PubChem CID 42067738) has the molecular formula C18H19N5OS and a molecular weight of 353.45 g/mol. Its IUPAC name is 2-[1-(3-methylphenyl)tetrazol-5-yl]sulfanyl-N-(2-phenylethyl)acetamide.
| Compound Name | 2-[1-(3-methylphenyl)tetrazol-5-yl]sulfanyl-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 42067738 |
| Molecular Formula | C18H19N5OS |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 2-[1-(3-methylphenyl)tetrazol-5-yl]sulfanyl-N-(2-phenylethyl)acetamide |
| SMILES | Cc1cccc(-n2nnnc2SCC(=O)NCCc2ccccc2)c1 |
| InChI | InChI=1S/C18H19N5OS/c1-14-6-5-9-16(12-14)23-18(20-21-22-23)25-13-17(24)19-11-10-15-7-3-2-4-8-15/h2-9,12H,10-11,13H2,1H3,(H,19,24) |
| InChIKey | JRMNFYNGAJGCGJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |