C12H18N2O2S2 — CID 61419001
2-methyl-5-(1,4-thiazepan-4-ylsulfonyl)aniline (PubChem CID 61419001) has the molecular formula C12H18N2O2S2 and a molecular weight of 286.42 g/mol. Its IUPAC name is 2-methyl-5-(1,4-thiazepan-4-ylsulfonyl)aniline.
| Compound Name | 2-methyl-5-(1,4-thiazepan-4-ylsulfonyl)aniline |
|---|---|
| PubChem CID | 61419001 |
| Molecular Formula | C12H18N2O2S2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 2-methyl-5-(1,4-thiazepan-4-ylsulfonyl)aniline |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCSCC2)cc1N |
| InChI | InChI=1S/C12H18N2O2S2/c1-10-3-4-11(9-12(10)13)18(15,16)14-5-2-7-17-8-6-14/h3-4,9H,2,5-8,13H2,1H3 |
| InChIKey | CCSTWBZVYQGZPJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|