C12H14F3NO2S2 — CID 52821226
4-[4-methyl-3-(trifluoromethyl)phenyl]sulfonylthiomorpholine (PubChem CID 52821226) has the molecular formula C12H14F3NO2S2 and a molecular weight of 325.38 g/mol. Its IUPAC name is 4-[4-methyl-3-(trifluoromethyl)phenyl]sulfonylthiomorpholine.
| Compound Name | 4-[4-methyl-3-(trifluoromethyl)phenyl]sulfonylthiomorpholine |
|---|---|
| PubChem CID | 52821226 |
| Molecular Formula | C12H14F3NO2S2 |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 4-[4-methyl-3-(trifluoromethyl)phenyl]sulfonylthiomorpholine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCSCC2)cc1C(F)(F)F |
| InChI | InChI=1S/C12H14F3NO2S2/c1-9-2-3-10(8-11(9)12(13,14)15)20(17,18)16-4-6-19-7-5-16/h2-3,8H,4-7H2,1H3 |
| InChIKey | WOJKPOWVYQNBGI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |