C9H13N3O2S2 — CID 62145270
4-thiomorpholin-4-ylsulfonylpyridin-2-amine (PubChem CID 62145270) has the molecular formula C9H13N3O2S2 and a molecular weight of 259.36 g/mol. Its IUPAC name is 4-thiomorpholin-4-ylsulfonylpyridin-2-amine.
| Compound Name | 4-thiomorpholin-4-ylsulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 62145270 |
| Molecular Formula | C9H13N3O2S2 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | 4-thiomorpholin-4-ylsulfonylpyridin-2-amine |
| SMILES | Nc1cc(S(=O)(=O)N2CCSCC2)ccn1 |
| InChI | InChI=1S/C9H13N3O2S2/c10-9-7-8(1-2-11-9)16(13,14)12-3-5-15-6-4-12/h1-2,7H,3-6H2,(H2,10,11) |
| InChIKey | UNEDYJXXLBJTRH-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |