C12H20N4O2S — CID 63605128
4-(4-ethyl-3-methylpiperazin-1-yl)sulfonylpyridin-2-amine (PubChem CID 63605128) has the molecular formula C12H20N4O2S and a molecular weight of 284.38 g/mol. Its IUPAC name is 4-(4-ethyl-3-methylpiperazin-1-yl)sulfonylpyridin-2-amine.
| Compound Name | 4-(4-ethyl-3-methylpiperazin-1-yl)sulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 63605128 |
| Molecular Formula | C12H20N4O2S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 4-(4-ethyl-3-methylpiperazin-1-yl)sulfonylpyridin-2-amine |
| SMILES | CCN1CCN(S(=O)(=O)c2ccnc(N)c2)CC1C |
| InChI | InChI=1S/C12H20N4O2S/c1-3-15-6-7-16(9-10(15)2)19(17,18)11-4-5-14-12(13)8-11/h4-5,8,10H,3,6-7,9H2,1-2H3,(H2,13,14) |
| InChIKey | BQNZCTAJPYSWFG-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |