C13H22N4O2S — CID 114613509
[5-(4-ethyl-3-methylpiperazin-1-yl)sulfonyl-2-pyridinyl]methanamine (PubChem CID 114613509) has the molecular formula C13H22N4O2S and a molecular weight of 298.41 g/mol. Its IUPAC name is [5-(4-ethyl-3-methylpiperazin-1-yl)sulfonyl-2-pyridinyl]methanamine.
| Compound Name | [5-(4-ethyl-3-methylpiperazin-1-yl)sulfonyl-2-pyridinyl]methanamine |
|---|---|
| PubChem CID | 114613509 |
| Molecular Formula | C13H22N4O2S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | [5-(4-ethyl-3-methylpiperazin-1-yl)sulfonyl-2-pyridinyl]methanamine |
| SMILES | CCN1CCN(S(=O)(=O)c2ccc(CN)nc2)CC1C |
| InChI | InChI=1S/C13H22N4O2S/c1-3-16-6-7-17(10-11(16)2)20(18,19)13-5-4-12(8-14)15-9-13/h4-5,9,11H,3,6-8,10,14H2,1-2H3 |
| InChIKey | ZSMIYSGPPGBYCH-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |