C12H19N3O3S — CID 114678175
1-[[6-(aminomethyl)-3-pyridinyl]sulfonyl]-3-methylpiperidin-4-ol (PubChem CID 114678175) has the molecular formula C12H19N3O3S and a molecular weight of 285.37 g/mol. Its IUPAC name is 1-[[6-(aminomethyl)-3-pyridinyl]sulfonyl]-3-methylpiperidin-4-ol.
| Compound Name | 1-[[6-(aminomethyl)-3-pyridinyl]sulfonyl]-3-methylpiperidin-4-ol |
|---|---|
| PubChem CID | 114678175 |
| Molecular Formula | C12H19N3O3S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 1-[[6-(aminomethyl)-3-pyridinyl]sulfonyl]-3-methylpiperidin-4-ol |
| SMILES | CC1CN(S(=O)(=O)c2ccc(CN)nc2)CCC1O |
| InChI | InChI=1S/C12H19N3O3S/c1-9-8-15(5-4-12(9)16)19(17,18)11-3-2-10(6-13)14-7-11/h2-3,7,9,12,16H,4-6,8,13H2,1H3 |
| InChIKey | USAJIRQKIWTMHY-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 96.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |