C12H18N4O4S — CID 114613701
methyl N-[1-[[6-(aminomethyl)-3-pyridinyl]sulfonyl]pyrrolidin-3-yl]carbamate (PubChem CID 114613701) has the molecular formula C12H18N4O4S and a molecular weight of 314.37 g/mol. Its IUPAC name is methyl N-[1-[[6-(aminomethyl)-3-pyridinyl]sulfonyl]pyrrolidin-3-yl]carbamate.
| Compound Name | methyl N-[1-[[6-(aminomethyl)-3-pyridinyl]sulfonyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 114613701 |
| Molecular Formula | C12H18N4O4S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | methyl N-[1-[[6-(aminomethyl)-3-pyridinyl]sulfonyl]pyrrolidin-3-yl]carbamate |
| SMILES | COC(=O)NC1CCN(S(=O)(=O)c2ccc(CN)nc2)C1 |
| InChI | InChI=1S/C12H18N4O4S/c1-20-12(17)15-10-4-5-16(8-10)21(18,19)11-3-2-9(6-13)14-7-11/h2-3,7,10H,4-6,8,13H2,1H3,(H,15,17) |
| InChIKey | HDBZJOQNYZGSAE-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |