C11H9F3N2O2S2 — CID 71975014
4-(1,3-thiazolidin-3-ylsulfonyl)-2-(trifluoromethyl)benzonitrile (PubChem CID 71975014) has the molecular formula C11H9F3N2O2S2 and a molecular weight of 322.33 g/mol. Its IUPAC name is 4-(1,3-thiazolidin-3-ylsulfonyl)-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-(1,3-thiazolidin-3-ylsulfonyl)-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 71975014 |
| Molecular Formula | C11H9F3N2O2S2 |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | 4-(1,3-thiazolidin-3-ylsulfonyl)-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(S(=O)(=O)N2CCSC2)cc1C(F)(F)F |
| InChI | InChI=1S/C11H9F3N2O2S2/c12-11(13,14)10-5-9(2-1-8(10)6-15)20(17,18)16-3-4-19-7-16/h1-2,5H,3-4,7H2 |
| InChIKey | VXPMEUVJEBIQKD-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |