C12H11F3N2OS — CID 60584985
4-(1-oxo-1,4-thiazinan-4-yl)-2-(trifluoromethyl)benzonitrile (PubChem CID 60584985) has the molecular formula C12H11F3N2OS and a molecular weight of 288.29 g/mol. Its IUPAC name is 4-(1-oxo-1,4-thiazinan-4-yl)-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-(1-oxo-1,4-thiazinan-4-yl)-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 60584985 |
| Molecular Formula | C12H11F3N2OS |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 4-(1-oxo-1,4-thiazinan-4-yl)-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(N2CCS(=O)CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C12H11F3N2OS/c13-12(14,15)11-7-10(2-1-9(11)8-16)17-3-5-19(18)6-4-17/h1-2,7H,3-6H2 |
| InChIKey | OYDCVUALNLSPIG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |