C18H22F3N3 — CID 133396140
4-[4-(2-methylpyrrolidin-1-yl)piperidin-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 133396140) has the molecular formula C18H22F3N3 and a molecular weight of 337.39 g/mol. Its IUPAC name is 4-[4-(2-methylpyrrolidin-1-yl)piperidin-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[4-(2-methylpyrrolidin-1-yl)piperidin-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 133396140 |
| Molecular Formula | C18H22F3N3 |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 4-[4-(2-methylpyrrolidin-1-yl)piperidin-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC1CCCN1C1CCN(c2ccc(C#N)c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C18H22F3N3/c1-13-3-2-8-24(13)15-6-9-23(10-7-15)16-5-4-14(12-22)17(11-16)18(19,20)21/h4-5,11,13,15H,2-3,6-10H2,1H3 |
| InChIKey | JVPGBCZWQBKGJI-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |