C17H20F3N3O2 — CID 122062329
2-[[1-[4-cyano-3-(trifluoromethyl)phenyl]piperidin-4-yl]-ethylamino]acetic acid (PubChem CID 122062329) has the molecular formula C17H20F3N3O2 and a molecular weight of 355.36 g/mol. Its IUPAC name is 2-[[1-[4-cyano-3-(trifluoromethyl)phenyl]piperidin-4-yl]-ethylamino]acetic acid.
| Compound Name | 2-[[1-[4-cyano-3-(trifluoromethyl)phenyl]piperidin-4-yl]-ethylamino]acetic acid |
|---|---|
| PubChem CID | 122062329 |
| Molecular Formula | C17H20F3N3O2 |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 2-[[1-[4-cyano-3-(trifluoromethyl)phenyl]piperidin-4-yl]-ethylamino]acetic acid |
| SMILES | CCN(CC(=O)O)C1CCN(c2ccc(C#N)c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C17H20F3N3O2/c1-2-22(11-16(24)25)13-5-7-23(8-6-13)14-4-3-12(10-21)15(9-14)17(18,19)20/h3-4,9,13H,2,5-8,11H2,1H3,(H,24,25) |
| InChIKey | SETUQVCCSKHCNB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |