C22H22F3N3O — CID 56554166
4-[4-(2-methyl-2-phenylpropanoyl)piperazin-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 56554166) has the molecular formula C22H22F3N3O and a molecular weight of 401.43 g/mol. Its IUPAC name is 4-[4-(2-methyl-2-phenylpropanoyl)piperazin-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[4-(2-methyl-2-phenylpropanoyl)piperazin-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 56554166 |
| Molecular Formula | C22H22F3N3O |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 4-[4-(2-methyl-2-phenylpropanoyl)piperazin-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC(C)(C(=O)N1CCN(c2ccc(C#N)c(C(F)(F)F)c2)CC1)c1ccccc1 |
| InChI | InChI=1S/C22H22F3N3O/c1-21(2,17-6-4-3-5-7-17)20(29)28-12-10-27(11-13-28)18-9-8-16(15-26)19(14-18)22(23,24)25/h3-9,14H,10-13H2,1-2H3 |
| InChIKey | APPILJUHAOIEKG-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |