C13H13F3N2O2S — CID 103739592
4-(1,1-dioxo-1,4-thiazepan-4-yl)-2-(trifluoromethyl)benzonitrile (PubChem CID 103739592) has the molecular formula C13H13F3N2O2S and a molecular weight of 318.32 g/mol. Its IUPAC name is 4-(1,1-dioxo-1,4-thiazepan-4-yl)-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-(1,1-dioxo-1,4-thiazepan-4-yl)-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 103739592 |
| Molecular Formula | C13H13F3N2O2S |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 4-(1,1-dioxo-1,4-thiazepan-4-yl)-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(N2CCCS(=O)(=O)CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C13H13F3N2O2S/c14-13(15,16)12-8-11(3-2-10(12)9-17)18-4-1-6-21(19,20)7-5-18/h2-3,8H,1,4-7H2 |
| InChIKey | GRXKIEGYWAUQBN-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |