C13H13F3N2O — CID 103868182
4-(3-hydroxy-3-methylpyrrolidin-1-yl)-2-(trifluoromethyl)benzonitrile (PubChem CID 103868182) has the molecular formula C13H13F3N2O and a molecular weight of 270.25 g/mol. Its IUPAC name is 4-(3-hydroxy-3-methylpyrrolidin-1-yl)-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-(3-hydroxy-3-methylpyrrolidin-1-yl)-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 103868182 |
| Molecular Formula | C13H13F3N2O |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 4-(3-hydroxy-3-methylpyrrolidin-1-yl)-2-(trifluoromethyl)benzonitrile |
| SMILES | CC1(O)CCN(c2ccc(C#N)c(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C13H13F3N2O/c1-12(19)4-5-18(8-12)10-3-2-9(7-17)11(6-10)13(14,15)16/h2-3,6,19H,4-5,8H2,1H3 |
| InChIKey | XHTHEALDNXWBPS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |