C12H11N3O2S — CID 104530048
4-(1,1-dioxo-1,4-thiazinan-4-yl)benzene-1,2-dicarbonitrile (PubChem CID 104530048) has the molecular formula C12H11N3O2S and a molecular weight of 261.31 g/mol. Its IUPAC name is 4-(1,1-dioxo-1,4-thiazinan-4-yl)benzene-1,2-dicarbonitrile.
| Compound Name | 4-(1,1-dioxo-1,4-thiazinan-4-yl)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 104530048 |
| Molecular Formula | C12H11N3O2S |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 4-(1,1-dioxo-1,4-thiazinan-4-yl)benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1ccc(N2CCS(=O)(=O)CC2)cc1C#N |
| InChI | InChI=1S/C12H11N3O2S/c13-8-10-1-2-12(7-11(10)9-14)15-3-5-18(16,17)6-4-15/h1-2,7H,3-6H2 |
| InChIKey | JLDNPRCSDSHGFP-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 84.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |