C15H17N3 — CID 114002357
4-(3-tert-butylazetidin-1-yl)benzene-1,2-dicarbonitrile (PubChem CID 114002357) has the molecular formula C15H17N3 and a molecular weight of 239.32 g/mol. Its IUPAC name is 4-(3-tert-butylazetidin-1-yl)benzene-1,2-dicarbonitrile.
| Compound Name | 4-(3-tert-butylazetidin-1-yl)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 114002357 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 4-(3-tert-butylazetidin-1-yl)benzene-1,2-dicarbonitrile |
| SMILES | CC(C)(C)C1CN(c2ccc(C#N)c(C#N)c2)C1 |
| InChI | InChI=1S/C15H17N3/c1-15(2,3)13-9-18(10-13)14-5-4-11(7-16)12(6-14)8-17/h4-6,13H,9-10H2,1-3H3 |
| InChIKey | YSKVJYZQWLMLSF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |