C14H15F3N2O2 — CID 103533403
5-(3,4-dimethoxypyrrolidin-1-yl)-2-(trifluoromethyl)benzonitrile (PubChem CID 103533403) has the molecular formula C14H15F3N2O2 and a molecular weight of 300.28 g/mol. Its IUPAC name is 5-(3,4-dimethoxypyrrolidin-1-yl)-2-(trifluoromethyl)benzonitrile.
| Compound Name | 5-(3,4-dimethoxypyrrolidin-1-yl)-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 103533403 |
| Molecular Formula | C14H15F3N2O2 |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 5-(3,4-dimethoxypyrrolidin-1-yl)-2-(trifluoromethyl)benzonitrile |
| SMILES | COC1CN(c2ccc(C(F)(F)F)c(C#N)c2)CC1OC |
| InChI | InChI=1S/C14H15F3N2O2/c1-20-12-7-19(8-13(12)21-2)10-3-4-11(14(15,16)17)9(5-10)6-18/h3-5,12-13H,7-8H2,1-2H3 |
| InChIKey | LOVHPEYSNZIHGP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |