C14H18FN3 — CID 114536900
2-fluoro-4-(3,4,5-trimethylpiperazin-1-yl)benzonitrile (PubChem CID 114536900) has the molecular formula C14H18FN3 and a molecular weight of 247.32 g/mol. Its IUPAC name is 2-fluoro-4-(3,4,5-trimethylpiperazin-1-yl)benzonitrile.
| Compound Name | 2-fluoro-4-(3,4,5-trimethylpiperazin-1-yl)benzonitrile |
|---|---|
| PubChem CID | 114536900 |
| Molecular Formula | C14H18FN3 |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | 2-fluoro-4-(3,4,5-trimethylpiperazin-1-yl)benzonitrile |
| SMILES | CC1CN(c2ccc(C#N)c(F)c2)CC(C)N1C |
| InChI | InChI=1S/C14H18FN3/c1-10-8-18(9-11(2)17(10)3)13-5-4-12(7-16)14(15)6-13/h4-6,10-11H,8-9H2,1-3H3 |
| InChIKey | WYHKMEVVZKQRJZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |