C12H13FN2 — CID 115367221
2-fluoro-4-(3-methylpyrrolidin-1-yl)benzonitrile (PubChem CID 115367221) has the molecular formula C12H13FN2 and a molecular weight of 204.25 g/mol. Its IUPAC name is 2-fluoro-4-(3-methylpyrrolidin-1-yl)benzonitrile.
| Compound Name | 2-fluoro-4-(3-methylpyrrolidin-1-yl)benzonitrile |
|---|---|
| PubChem CID | 115367221 |
| Molecular Formula | C12H13FN2 |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | 2-fluoro-4-(3-methylpyrrolidin-1-yl)benzonitrile |
| SMILES | CC1CCN(c2ccc(C#N)c(F)c2)C1 |
| InChI | InChI=1S/C12H13FN2/c1-9-4-5-15(8-9)11-3-2-10(7-14)12(13)6-11/h2-3,6,9H,4-5,8H2,1H3 |
| InChIKey | NDQWSABZNVCIIP-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |