C15H15NO3S2 — CID 852139
3-(4-phenoxyphenyl)sulfonyl-1,3-thiazolidine (PubChem CID 852139) has the molecular formula C15H15NO3S2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 3-(4-phenoxyphenyl)sulfonyl-1,3-thiazolidine.
| Compound Name | 3-(4-phenoxyphenyl)sulfonyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 852139 |
| Molecular Formula | C15H15NO3S2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 3-(4-phenoxyphenyl)sulfonyl-1,3-thiazolidine |
| SMILES | O=S(=O)(c1ccc(Oc2ccccc2)cc1)N1CCSC1 |
| InChI | InChI=1S/C15H15NO3S2/c17-21(18,16-10-11-20-12-16)15-8-6-14(7-9-15)19-13-4-2-1-3-5-13/h1-9H,10-12H2 |
| InChIKey | CSEHFNVGDLJHFL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |