C13H18ClF3N2O2S — CID 119959016
1-[4-methyl-3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-amine;hydrochloride (PubChem CID 119959016) has the molecular formula C13H18ClF3N2O2S and a molecular weight of 358.81 g/mol. Its IUPAC name is 1-[4-methyl-3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-amine;hydrochloride.
| Compound Name | 1-[4-methyl-3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 119959016 |
| Molecular Formula | C13H18ClF3N2O2S |
| Molecular Weight | 358.81 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 1-[4-methyl-3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-amine;hydrochloride |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(N)CC2)cc1C(F)(F)F.Cl |
| InChI | InChI=1S/C13H17F3N2O2S.ClH/c1-9-2-3-11(8-12(9)13(14,15)16)21(19,20)18-6-4-10(17)5-7-18;/h2-3,8,10H,4-7,17H2,1H3;1H |
| InChIKey | IERVQUMXQDRZGY-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.81 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |