C12H14F4N2O2S — CID 119959379
1-[4-fluoro-3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-amine (PubChem CID 119959379) has the molecular formula C12H14F4N2O2S and a molecular weight of 326.32 g/mol. Its IUPAC name is 1-[4-fluoro-3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-amine.
| Compound Name | 1-[4-fluoro-3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-amine |
|---|---|
| PubChem CID | 119959379 |
| Molecular Formula | C12H14F4N2O2S |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 1-[4-fluoro-3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-amine |
| SMILES | NC1CCN(S(=O)(=O)c2ccc(F)c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C12H14F4N2O2S/c13-11-2-1-9(7-10(11)12(14,15)16)21(19,20)18-5-3-8(17)4-6-18/h1-2,7-8H,3-6,17H2 |
| InChIKey | WOXBWMWRCMLPFU-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |