C11H16N4O2S2 — CID 169360083
(4-piperazin-1-ylsulfonylphenyl)thiourea (PubChem CID 169360083) has the molecular formula C11H16N4O2S2 and a molecular weight of 300.41 g/mol. Its IUPAC name is (4-piperazin-1-ylsulfonylphenyl)thiourea.
| Compound Name | (4-piperazin-1-ylsulfonylphenyl)thiourea |
|---|---|
| PubChem CID | 169360083 |
| Molecular Formula | C11H16N4O2S2 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | (4-piperazin-1-ylsulfonylphenyl)thiourea |
| SMILES | NC(=S)Nc1ccc(S(=O)(=O)N2CCNCC2)cc1 |
| InChI | InChI=1S/C11H16N4O2S2/c12-11(18)14-9-1-3-10(4-2-9)19(16,17)15-7-5-13-6-8-15/h1-4,13H,5-8H2,(H3,12,14,18) |
| InChIKey | PJXIPKPLXBGFNK-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|