C13H20N4O3S2 — CID 169356209
[4-[4-(2-hydroxyethyl)piperazin-1-yl]sulfonylphenyl]thiourea (PubChem CID 169356209) has the molecular formula C13H20N4O3S2 and a molecular weight of 344.46 g/mol. Its IUPAC name is [4-[4-(2-hydroxyethyl)piperazin-1-yl]sulfonylphenyl]thiourea.
| Compound Name | [4-[4-(2-hydroxyethyl)piperazin-1-yl]sulfonylphenyl]thiourea |
|---|---|
| PubChem CID | 169356209 |
| Molecular Formula | C13H20N4O3S2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | [4-[4-(2-hydroxyethyl)piperazin-1-yl]sulfonylphenyl]thiourea |
| SMILES | NC(=S)Nc1ccc(S(=O)(=O)N2CCN(CCO)CC2)cc1 |
| InChI | InChI=1S/C13H20N4O3S2/c14-13(21)15-11-1-3-12(4-2-11)22(19,20)17-7-5-16(6-8-17)9-10-18/h1-4,18H,5-10H2,(H3,14,15,21) |
| InChIKey | NNEVETBCPZLKEV-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|