C12H16FN3O2S2 — CID 63336604
2-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]ethanethioamide (PubChem CID 63336604) has the molecular formula C12H16FN3O2S2 and a molecular weight of 317.41 g/mol. Its IUPAC name is 2-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]ethanethioamide.
| Compound Name | 2-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]ethanethioamide |
|---|---|
| PubChem CID | 63336604 |
| Molecular Formula | C12H16FN3O2S2 |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 2-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]ethanethioamide |
| SMILES | NC(=S)CN1CCN(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C12H16FN3O2S2/c13-10-1-3-11(4-2-10)20(17,18)16-7-5-15(6-8-16)9-12(14)19/h1-4H,5-9H2,(H2,14,19) |
| InChIKey | GPFVAEIKAJCGGR-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|