C15H21FN4O4S — CID 8688551
2-[[2-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]acetyl]amino]-N-methylacetamide (PubChem CID 8688551) has the molecular formula C15H21FN4O4S and a molecular weight of 372.42 g/mol. Its IUPAC name is 2-[[2-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]acetyl]amino]-N-methylacetamide.
| Compound Name | 2-[[2-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]acetyl]amino]-N-methylacetamide |
|---|---|
| PubChem CID | 8688551 |
| Molecular Formula | C15H21FN4O4S |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 2-[[2-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]acetyl]amino]-N-methylacetamide |
| SMILES | CNC(=O)CNC(=O)CN1CCN(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C15H21FN4O4S/c1-17-14(21)10-18-15(22)11-19-6-8-20(9-7-19)25(23,24)13-4-2-12(16)3-5-13/h2-5H,6-11H2,1H3,(H,17,21)(H,18,22) |
| InChIKey | SOBVPBIKTMAGSG-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |