C15H18FN3O3S — CID 8688477
2-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-N-prop-2-ynylacetamide (PubChem CID 8688477) has the molecular formula C15H18FN3O3S and a molecular weight of 339.39 g/mol. Its IUPAC name is 2-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-N-prop-2-ynylacetamide.
| Compound Name | 2-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-N-prop-2-ynylacetamide |
|---|---|
| PubChem CID | 8688477 |
| Molecular Formula | C15H18FN3O3S |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 2-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-N-prop-2-ynylacetamide |
| SMILES | C#CCNC(=O)CN1CCN(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C15H18FN3O3S/c1-2-7-17-15(20)12-18-8-10-19(11-9-18)23(21,22)14-5-3-13(16)4-6-14/h1,3-6H,7-12H2,(H,17,20) |
| InChIKey | TUETYIXFZHMMIE-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|