C17H23N3O3S — CID 8787857
2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-N-prop-2-ynylacetamide (PubChem CID 8787857) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is 2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-N-prop-2-ynylacetamide.
| Compound Name | 2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-N-prop-2-ynylacetamide |
|---|---|
| PubChem CID | 8787857 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-N-prop-2-ynylacetamide |
| SMILES | C#CCNC(=O)CN1CCN(S(=O)(=O)c2ccc(C)cc2C)CC1 |
| InChI | InChI=1S/C17H23N3O3S/c1-4-7-18-17(21)13-19-8-10-20(11-9-19)24(22,23)16-6-5-14(2)12-15(16)3/h1,5-6,12H,7-11,13H2,2-3H3,(H,18,21) |
| InChIKey | COGUGITUDRPVTR-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|