C18H24N4O6S — CID 168557317
1-(2-hydroxyethyl)-3-[4-[4-(2-hydroxyethyl)piperazin-1-yl]sulfonylanilino]pyrrole-2,5-dione (PubChem CID 168557317) has the molecular formula C18H24N4O6S and a molecular weight of 424.48 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-[4-[4-(2-hydroxyethyl)piperazin-1-yl]sulfonylanilino]pyrrole-2,5-dione.
| Compound Name | 1-(2-hydroxyethyl)-3-[4-[4-(2-hydroxyethyl)piperazin-1-yl]sulfonylanilino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168557317 |
| Molecular Formula | C18H24N4O6S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-[4-[4-(2-hydroxyethyl)piperazin-1-yl]sulfonylanilino]pyrrole-2,5-dione |
| SMILES | O=C1C=C(Nc2ccc(S(=O)(=O)N3CCN(CCO)CC3)cc2)C(=O)N1CCO |
| InChI | InChI=1S/C18H24N4O6S/c23-11-9-20-5-7-21(8-6-20)29(27,28)15-3-1-14(2-4-15)19-16-13-17(25)22(10-12-24)18(16)26/h1-4,13,19,23-24H,5-12H2 |
| InChIKey | SZDNYURGFSVSHB-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 130.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|