C13H11F3N2O3S — CID 168559349
1-(2-hydroxyethyl)-3-[4-(trifluoromethylsulfanyl)anilino]pyrrole-2,5-dione (PubChem CID 168559349) has the molecular formula C13H11F3N2O3S and a molecular weight of 332.30 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-[4-(trifluoromethylsulfanyl)anilino]pyrrole-2,5-dione.
| Compound Name | 1-(2-hydroxyethyl)-3-[4-(trifluoromethylsulfanyl)anilino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168559349 |
| Molecular Formula | C13H11F3N2O3S |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-[4-(trifluoromethylsulfanyl)anilino]pyrrole-2,5-dione |
| SMILES | O=C1C=C(Nc2ccc(SC(F)(F)F)cc2)C(=O)N1CCO |
| InChI | InChI=1S/C13H11F3N2O3S/c14-13(15,16)22-9-3-1-8(2-4-9)17-10-7-11(20)18(5-6-19)12(10)21/h1-4,7,17,19H,5-6H2 |
| InChIKey | QTADQCLWOWPRIF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|